C14H21Cl2N3 — CID 102757811
3,5-dichloro-N-methyl-6-(4-propylpiperidin-1-yl)pyridin-2-amine (PubChem CID 102757811) has the molecular formula C14H21Cl2N3 and a molecular weight of 302.25 g/mol. Its IUPAC name is 3,5-dichloro-N-methyl-6-(4-propylpiperidin-1-yl)pyridin-2-amine.
| Compound Name | 3,5-dichloro-N-methyl-6-(4-propylpiperidin-1-yl)pyridin-2-amine |
|---|---|
| PubChem CID | 102757811 |
| Molecular Formula | C14H21Cl2N3 |
| Molecular Weight | 302.25 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | 3,5-dichloro-N-methyl-6-(4-propylpiperidin-1-yl)pyridin-2-amine |
| SMILES | CCCC1CCN(c2nc(NC)c(Cl)cc2Cl)CC1 |
| InChI | InChI=1S/C14H21Cl2N3/c1-3-4-10-5-7-19(8-6-10)14-12(16)9-11(15)13(17-2)18-14/h9-10H,3-8H2,1-2H3,(H,17,18) |
| InChIKey | YBTABIHWLXTADC-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.25 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |