C14H19Cl3N2 — CID 102751213
4-propyl-1-(3,5,6-trichloro-2-pyridinyl)azepane (PubChem CID 102751213) has the molecular formula C14H19Cl3N2 and a molecular weight of 321.68 g/mol. Its IUPAC name is 4-propyl-1-(3,5,6-trichloro-2-pyridinyl)azepane.
| Compound Name | 4-propyl-1-(3,5,6-trichloro-2-pyridinyl)azepane |
|---|---|
| PubChem CID | 102751213 |
| Molecular Formula | C14H19Cl3N2 |
| Molecular Weight | 321.68 g/mol |
| Exact Mass | 320.06 |
| IUPAC Name | 4-propyl-1-(3,5,6-trichloro-2-pyridinyl)azepane |
| SMILES | CCCC1CCCN(c2nc(Cl)c(Cl)cc2Cl)CC1 |
| InChI | InChI=1S/C14H19Cl3N2/c1-2-4-10-5-3-7-19(8-6-10)14-12(16)9-11(15)13(17)18-14/h9-10H,2-8H2,1H3 |
| InChIKey | TYGDEVGLCAMSRD-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.68 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|