About 1-(3,5,6-trichloro-2-pyridinyl)piperidin-3-ol
1-(3,5,6-trichloro-2-pyridinyl)piperidin-3-ol (PubChem CID 102750356) has the molecular formula C10H11Cl3N2O
and a molecular weight of 281.57 g/mol. Its IUPAC name is 1-(3,5,6-trichloro-2-pyridinyl)piperidin-3-ol.
Molecular Properties
| Compound Name | 1-(3,5,6-trichloro-2-pyridinyl)piperidin-3-ol |
| PubChem CID | 102750356 |
| Molecular Formula | C10H11Cl3N2O |
| Molecular Weight | 281.57 g/mol |
| Exact Mass | 279.99 |
| IUPAC Name | 1-(3,5,6-trichloro-2-pyridinyl)piperidin-3-ol |
| SMILES | OC1CCCN(c2nc(Cl)c(Cl)cc2Cl)C1 |
| InChI | InChI=1S/C10H11Cl3N2O/c11-7-4-8(12)10(14-9(7)13)15-3-1-2-6(16)5-15/h4,6,16H,1-3,5H2 |
| InChIKey | DFPLKNMOACAHAO-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.57 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 1-(3,5,6-trichloro-2-pyridinyl)piperidin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,5,6-trichloro-2-pyridinyl)piperidin-3-ol?
The IUPAC name of 1-(3,5,6-trichloro-2-pyridinyl)piperidin-3-ol (CID 102750356) is 1-(3,5,6-trichloro-2-pyridinyl)piperidin-3-ol.
What is the SMILES notation for 1-(3,5,6-trichloro-2-pyridinyl)piperidin-3-ol?
The canonical SMILES for 1-(3,5,6-trichloro-2-pyridinyl)piperidin-3-ol is OC1CCCN(c2nc(Cl)c(Cl)cc2Cl)C1.
What is the InChIKey of 1-(3,5,6-trichloro-2-pyridinyl)piperidin-3-ol?
The InChIKey is DFPLKNMOACAHAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11Cl3N2O/c11-7-4-8(12)10(14-9(7)13)15-3-1-2-6(16)5-15/h4,6,16H,1-3,5H2.
What are the key properties of 1-(3,5,6-trichloro-2-pyridinyl)piperidin-3-ol?
1-(3,5,6-trichloro-2-pyridinyl)piperidin-3-ol has a molecular weight of 281.57 g/mol, XLogP of 3.00, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,5,6-trichloro-2-pyridinyl)piperidin-3-ol is sourced from PubChem (CID 102750356), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).