C12H15Cl3N2 — CID 102752005
2,3,5-trichloro-6-(3,4-dimethylpiperidin-1-yl)pyridine (PubChem CID 102752005) has the molecular formula C12H15Cl3N2 and a molecular weight of 293.63 g/mol. Its IUPAC name is 2,3,5-trichloro-6-(3,4-dimethylpiperidin-1-yl)pyridine.
| Compound Name | 2,3,5-trichloro-6-(3,4-dimethylpiperidin-1-yl)pyridine |
|---|---|
| PubChem CID | 102752005 |
| Molecular Formula | C12H15Cl3N2 |
| Molecular Weight | 293.63 g/mol |
| Exact Mass | 292.03 |
| IUPAC Name | 2,3,5-trichloro-6-(3,4-dimethylpiperidin-1-yl)pyridine |
| SMILES | CC1CCN(c2nc(Cl)c(Cl)cc2Cl)CC1C |
| InChI | InChI=1S/C12H15Cl3N2/c1-7-3-4-17(6-8(7)2)12-10(14)5-9(13)11(15)16-12/h5,7-8H,3-4,6H2,1-2H3 |
| InChIKey | XDJAQKSWQQPCQP-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.63 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|