C12H17ClN2 — CID 103878204
2-chloro-4-(3,4-dimethylpiperidin-1-yl)pyridine (PubChem CID 103878204) has the molecular formula C12H17ClN2 and a molecular weight of 224.73 g/mol. Its IUPAC name is 2-chloro-4-(3,4-dimethylpiperidin-1-yl)pyridine.
| Compound Name | 2-chloro-4-(3,4-dimethylpiperidin-1-yl)pyridine |
|---|---|
| PubChem CID | 103878204 |
| Molecular Formula | C12H17ClN2 |
| Molecular Weight | 224.73 g/mol |
| Exact Mass | 224.11 |
| IUPAC Name | 2-chloro-4-(3,4-dimethylpiperidin-1-yl)pyridine |
| SMILES | CC1CCN(c2ccnc(Cl)c2)CC1C |
| InChI | InChI=1S/C12H17ClN2/c1-9-4-6-15(8-10(9)2)11-3-5-14-12(13)7-11/h3,5,7,9-10H,4,6,8H2,1-2H3 |
| InChIKey | UAXAAGVBTGXUCT-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.73 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|