C10H11ClN2O2 — CID 129353758
(3R)-1-(2-chloro-4-pyridinyl)pyrrolidine-3-carboxylic acid (PubChem CID 129353758) has the molecular formula C10H11ClN2O2 and a molecular weight of 226.66 g/mol. Its IUPAC name is (3R)-1-(2-chloro-4-pyridinyl)pyrrolidine-3-carboxylic acid.
| Compound Name | (3R)-1-(2-chloro-4-pyridinyl)pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 129353758 |
| Molecular Formula | C10H11ClN2O2 |
| Molecular Weight | 226.66 g/mol |
| Exact Mass | 226.05 |
| IUPAC Name | (3R)-1-(2-chloro-4-pyridinyl)pyrrolidine-3-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CCN(c2ccnc(Cl)c2)C1 |
| InChI | InChI=1S/C10H11ClN2O2/c11-9-5-8(1-3-12-9)13-4-2-7(6-13)10(14)15/h1,3,5,7H,2,4,6H2,(H,14,15)/t7-/m1/s1 |
| InChIKey | UCMRUDQGOSLVDL-SSDOTTSWSA-N |
| XLogP | 1.65 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.66 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|