C11H13BrCl2N2 — CID 114682770
2-(4-bromo-3-methylpiperidin-1-yl)-3,5-dichloropyridine (PubChem CID 114682770) has the molecular formula C11H13BrCl2N2 and a molecular weight of 324.05 g/mol. Its IUPAC name is 2-(4-bromo-3-methylpiperidin-1-yl)-3,5-dichloropyridine.
| Compound Name | 2-(4-bromo-3-methylpiperidin-1-yl)-3,5-dichloropyridine |
|---|---|
| PubChem CID | 114682770 |
| Molecular Formula | C11H13BrCl2N2 |
| Molecular Weight | 324.05 g/mol |
| Exact Mass | 321.96 |
| IUPAC Name | 2-(4-bromo-3-methylpiperidin-1-yl)-3,5-dichloropyridine |
| SMILES | CC1CN(c2ncc(Cl)cc2Cl)CCC1Br |
| InChI | InChI=1S/C11H13BrCl2N2/c1-7-6-16(3-2-9(7)12)11-10(14)4-8(13)5-15-11/h4-5,7,9H,2-3,6H2,1H3 |
| InChIKey | HYYMTRDNNQUKGZ-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.05 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|