About 2-(4-bromo-3-methylpiperidin-1-yl)-3,5-dichloropyridine
2-(4-bromo-3-methylpiperidin-1-yl)-3,5-dichloropyridine (PubChem CID 114682770) has the molecular formula C11H13BrCl2N2
and a molecular weight of 324.05 g/mol. Its IUPAC name is 2-(4-bromo-3-methylpiperidin-1-yl)-3,5-dichloropyridine.
Molecular Properties
| Compound Name | 2-(4-bromo-3-methylpiperidin-1-yl)-3,5-dichloropyridine |
| PubChem CID | 114682770 |
| Molecular Formula | C11H13BrCl2N2 |
| Molecular Weight | 324.05 g/mol |
| Exact Mass | 321.96 |
| IUPAC Name | 2-(4-bromo-3-methylpiperidin-1-yl)-3,5-dichloropyridine |
| SMILES | CC1CN(c2ncc(Cl)cc2Cl)CCC1Br |
| InChI | InChI=1S/C11H13BrCl2N2/c1-7-6-16(3-2-9(7)12)11-10(14)4-8(13)5-15-11/h4-5,7,9H,2-3,6H2,1H3 |
| InChIKey | HYYMTRDNNQUKGZ-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.05 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-bromo-3-methylpiperidin-1-yl)-3,5-dichloropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-bromo-3-methylpiperidin-1-yl)-3,5-dichloropyridine?
The IUPAC name of 2-(4-bromo-3-methylpiperidin-1-yl)-3,5-dichloropyridine (CID 114682770) is 2-(4-bromo-3-methylpiperidin-1-yl)-3,5-dichloropyridine.
What is the SMILES notation for 2-(4-bromo-3-methylpiperidin-1-yl)-3,5-dichloropyridine?
The canonical SMILES for 2-(4-bromo-3-methylpiperidin-1-yl)-3,5-dichloropyridine is CC1CN(c2ncc(Cl)cc2Cl)CCC1Br.
What is the InChIKey of 2-(4-bromo-3-methylpiperidin-1-yl)-3,5-dichloropyridine?
The InChIKey is HYYMTRDNNQUKGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13BrCl2N2/c1-7-6-16(3-2-9(7)12)11-10(14)4-8(13)5-15-11/h4-5,7,9H,2-3,6H2,1H3.
What are the key properties of 2-(4-bromo-3-methylpiperidin-1-yl)-3,5-dichloropyridine?
2-(4-bromo-3-methylpiperidin-1-yl)-3,5-dichloropyridine has a molecular weight of 324.05 g/mol, XLogP of 4.00, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-bromo-3-methylpiperidin-1-yl)-3,5-dichloropyridine is sourced from PubChem (CID 114682770), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).