C10H11BrCl2N2O — CID 81210900
2-(bromomethyl)-4-(3,5-dichloro-2-pyridinyl)morpholine (PubChem CID 81210900) has the molecular formula C10H11BrCl2N2O and a molecular weight of 326.02 g/mol. Its IUPAC name is 2-(bromomethyl)-4-(3,5-dichloro-2-pyridinyl)morpholine.
| Compound Name | 2-(bromomethyl)-4-(3,5-dichloro-2-pyridinyl)morpholine |
|---|---|
| PubChem CID | 81210900 |
| Molecular Formula | C10H11BrCl2N2O |
| Molecular Weight | 326.02 g/mol |
| Exact Mass | 323.94 |
| IUPAC Name | 2-(bromomethyl)-4-(3,5-dichloro-2-pyridinyl)morpholine |
| SMILES | Clc1cnc(N2CCOC(CBr)C2)c(Cl)c1 |
| InChI | InChI=1S/C10H11BrCl2N2O/c11-4-8-6-15(1-2-16-8)10-9(13)3-7(12)5-14-10/h3,5,8H,1-2,4,6H2 |
| InChIKey | RFJOIYWIGTYXMH-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.02 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|