C11H13Cl2N3O — CID 2480749
1-[4-(3,5-dichloro-2-pyridinyl)piperazin-1-yl]ethanone (PubChem CID 2480749) has the molecular formula C11H13Cl2N3O and a molecular weight of 274.15 g/mol. Its IUPAC name is 1-[4-(3,5-dichloro-2-pyridinyl)piperazin-1-yl]ethanone.
| Compound Name | 1-[4-(3,5-dichloro-2-pyridinyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 2480749 |
| Molecular Formula | C11H13Cl2N3O |
| Molecular Weight | 274.15 g/mol |
| Exact Mass | 273.04 |
| IUPAC Name | 1-[4-(3,5-dichloro-2-pyridinyl)piperazin-1-yl]ethanone |
| SMILES | CC(=O)N1CCN(c2ncc(Cl)cc2Cl)CC1 |
| InChI | InChI=1S/C11H13Cl2N3O/c1-8(17)15-2-4-16(5-3-15)11-10(13)6-9(12)7-14-11/h6-7H,2-5H2,1H3 |
| InChIKey | XPGSIDFMMJJEAX-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.15 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |