C12H15Cl2N3O — CID 166604874
1-[4-(3,5-dichloro-2-pyridinyl)-1,4-diazepan-1-yl]ethanone (PubChem CID 166604874) has the molecular formula C12H15Cl2N3O and a molecular weight of 288.18 g/mol. Its IUPAC name is 1-[4-(3,5-dichloro-2-pyridinyl)-1,4-diazepan-1-yl]ethanone.
| Compound Name | 1-[4-(3,5-dichloro-2-pyridinyl)-1,4-diazepan-1-yl]ethanone |
|---|---|
| PubChem CID | 166604874 |
| Molecular Formula | C12H15Cl2N3O |
| Molecular Weight | 288.18 g/mol |
| Exact Mass | 287.06 |
| IUPAC Name | 1-[4-(3,5-dichloro-2-pyridinyl)-1,4-diazepan-1-yl]ethanone |
| SMILES | CC(=O)N1CCCN(c2ncc(Cl)cc2Cl)CC1 |
| InChI | InChI=1S/C12H15Cl2N3O/c1-9(18)16-3-2-4-17(6-5-16)12-11(14)7-10(13)8-15-12/h7-8H,2-6H2,1H3 |
| InChIKey | CMMBWMUTNHILDV-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.18 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |