C9H10Cl3N3 — CID 103607077
1-(3,5,6-trichloro-2-pyridinyl)piperazine (PubChem CID 103607077) has the molecular formula C9H10Cl3N3 and a molecular weight of 266.56 g/mol. Its IUPAC name is 1-(3,5,6-trichloro-2-pyridinyl)piperazine.
| Compound Name | 1-(3,5,6-trichloro-2-pyridinyl)piperazine |
|---|---|
| PubChem CID | 103607077 |
| Molecular Formula | C9H10Cl3N3 |
| Molecular Weight | 266.56 g/mol |
| Exact Mass | 264.99 |
| IUPAC Name | 1-(3,5,6-trichloro-2-pyridinyl)piperazine |
| SMILES | Clc1cc(Cl)c(N2CCNCC2)nc1Cl |
| InChI | InChI=1S/C9H10Cl3N3/c10-6-5-7(11)9(14-8(6)12)15-3-1-13-2-4-15/h5,13H,1-4H2 |
| InChIKey | ZJOMFJWTOOUCQG-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.56 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|