C15H13Cl3N2 — CID 102751220
3-(3,5,6-trichloro-2-pyridinyl)-1,2,4,5-tetrahydro-3-benzazepine (PubChem CID 102751220) has the molecular formula C15H13Cl3N2 and a molecular weight of 327.64 g/mol. Its IUPAC name is 3-(3,5,6-trichloro-2-pyridinyl)-1,2,4,5-tetrahydro-3-benzazepine.
| Compound Name | 3-(3,5,6-trichloro-2-pyridinyl)-1,2,4,5-tetrahydro-3-benzazepine |
|---|---|
| PubChem CID | 102751220 |
| Molecular Formula | C15H13Cl3N2 |
| Molecular Weight | 327.64 g/mol |
| Exact Mass | 326.01 |
| IUPAC Name | 3-(3,5,6-trichloro-2-pyridinyl)-1,2,4,5-tetrahydro-3-benzazepine |
| SMILES | Clc1cc(Cl)c(N2CCc3ccccc3CC2)nc1Cl |
| InChI | InChI=1S/C15H13Cl3N2/c16-12-9-13(17)15(19-14(12)18)20-7-5-10-3-1-2-4-11(10)6-8-20/h1-4,9H,5-8H2 |
| InChIKey | HTKPDMAZKXVDCN-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.64 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|