C14H11Cl3N2 — CID 102749863
2-methyl-1-(3,5,6-trichloro-2-pyridinyl)-2,3-dihydroindole (PubChem CID 102749863) has the molecular formula C14H11Cl3N2 and a molecular weight of 313.62 g/mol. Its IUPAC name is 2-methyl-1-(3,5,6-trichloro-2-pyridinyl)-2,3-dihydroindole.
| Compound Name | 2-methyl-1-(3,5,6-trichloro-2-pyridinyl)-2,3-dihydroindole |
|---|---|
| PubChem CID | 102749863 |
| Molecular Formula | C14H11Cl3N2 |
| Molecular Weight | 313.62 g/mol |
| Exact Mass | 312.00 |
| IUPAC Name | 2-methyl-1-(3,5,6-trichloro-2-pyridinyl)-2,3-dihydroindole |
| SMILES | CC1Cc2ccccc2N1c1nc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C14H11Cl3N2/c1-8-6-9-4-2-3-5-12(9)19(8)14-11(16)7-10(15)13(17)18-14/h2-5,7-8H,6H2,1H3 |
| InChIKey | HDVGMCJZEVIDEO-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.62 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|