C13H12Cl2N2S — CID 80687390
4-chloro-5-(chloromethyl)-2-(2-methyl-2,3-dihydroindol-1-yl)-1,3-thiazole (PubChem CID 80687390) has the molecular formula C13H12Cl2N2S and a molecular weight of 299.23 g/mol. Its IUPAC name is 4-chloro-5-(chloromethyl)-2-(2-methyl-2,3-dihydroindol-1-yl)-1,3-thiazole.
| Compound Name | 4-chloro-5-(chloromethyl)-2-(2-methyl-2,3-dihydroindol-1-yl)-1,3-thiazole |
|---|---|
| PubChem CID | 80687390 |
| Molecular Formula | C13H12Cl2N2S |
| Molecular Weight | 299.23 g/mol |
| Exact Mass | 298.01 |
| IUPAC Name | 4-chloro-5-(chloromethyl)-2-(2-methyl-2,3-dihydroindol-1-yl)-1,3-thiazole |
| SMILES | CC1Cc2ccccc2N1c1nc(Cl)c(CCl)s1 |
| InChI | InChI=1S/C13H12Cl2N2S/c1-8-6-9-4-2-3-5-10(9)17(8)13-16-12(15)11(7-14)18-13/h2-5,8H,6-7H2,1H3 |
| InChIKey | QMBMJSULELDDSV-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.23 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|