C12H11BrN2S — CID 79398878
4-bromo-2-(2-methyl-2,3-dihydroindol-1-yl)-1,3-thiazole (PubChem CID 79398878) has the molecular formula C12H11BrN2S and a molecular weight of 295.21 g/mol. Its IUPAC name is 4-bromo-2-(2-methyl-2,3-dihydroindol-1-yl)-1,3-thiazole.
| Compound Name | 4-bromo-2-(2-methyl-2,3-dihydroindol-1-yl)-1,3-thiazole |
|---|---|
| PubChem CID | 79398878 |
| Molecular Formula | C12H11BrN2S |
| Molecular Weight | 295.21 g/mol |
| Exact Mass | 293.98 |
| IUPAC Name | 4-bromo-2-(2-methyl-2,3-dihydroindol-1-yl)-1,3-thiazole |
| SMILES | CC1Cc2ccccc2N1c1nc(Br)cs1 |
| InChI | InChI=1S/C12H11BrN2S/c1-8-6-9-4-2-3-5-10(9)15(8)12-14-11(13)7-16-12/h2-5,7-8H,6H2,1H3 |
| InChIKey | ALFOIFKTJNOMOS-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.21 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |