C16H17BrN2 — CID 107274667
[2-bromo-4-(2-methyl-2,3-dihydroindol-1-yl)phenyl]methanamine (PubChem CID 107274667) has the molecular formula C16H17BrN2 and a molecular weight of 317.23 g/mol. Its IUPAC name is [2-bromo-4-(2-methyl-2,3-dihydroindol-1-yl)phenyl]methanamine.
| Compound Name | [2-bromo-4-(2-methyl-2,3-dihydroindol-1-yl)phenyl]methanamine |
|---|---|
| PubChem CID | 107274667 |
| Molecular Formula | C16H17BrN2 |
| Molecular Weight | 317.23 g/mol |
| Exact Mass | 316.06 |
| IUPAC Name | [2-bromo-4-(2-methyl-2,3-dihydroindol-1-yl)phenyl]methanamine |
| SMILES | CC1Cc2ccccc2N1c1ccc(CN)c(Br)c1 |
| InChI | InChI=1S/C16H17BrN2/c1-11-8-12-4-2-3-5-16(12)19(11)14-7-6-13(10-18)15(17)9-14/h2-7,9,11H,8,10,18H2,1H3 |
| InChIKey | SCAXMXFDJOTPHG-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.23 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |