C17H18ClN — CID 63540213
1-[4-(chloromethyl)-3-methylphenyl]-2-methyl-2,3-dihydroindole (PubChem CID 63540213) has the molecular formula C17H18ClN and a molecular weight of 271.79 g/mol. Its IUPAC name is 1-[4-(chloromethyl)-3-methylphenyl]-2-methyl-2,3-dihydroindole.
| Compound Name | 1-[4-(chloromethyl)-3-methylphenyl]-2-methyl-2,3-dihydroindole |
|---|---|
| PubChem CID | 63540213 |
| Molecular Formula | C17H18ClN |
| Molecular Weight | 271.79 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | 1-[4-(chloromethyl)-3-methylphenyl]-2-methyl-2,3-dihydroindole |
| SMILES | Cc1cc(N2c3ccccc3CC2C)ccc1CCl |
| InChI | InChI=1S/C17H18ClN/c1-12-9-16(8-7-15(12)11-18)19-13(2)10-14-5-3-4-6-17(14)19/h3-9,13H,10-11H2,1-2H3 |
| InChIKey | TWZDMDKQCWQPSU-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.79 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|