C16H13ClN2 — CID 55194409
2-chloro-4-(2-methyl-2,3-dihydroindol-1-yl)benzonitrile (PubChem CID 55194409) has the molecular formula C16H13ClN2 and a molecular weight of 268.75 g/mol. Its IUPAC name is 2-chloro-4-(2-methyl-2,3-dihydroindol-1-yl)benzonitrile.
| Compound Name | 2-chloro-4-(2-methyl-2,3-dihydroindol-1-yl)benzonitrile |
|---|---|
| PubChem CID | 55194409 |
| Molecular Formula | C16H13ClN2 |
| Molecular Weight | 268.75 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | 2-chloro-4-(2-methyl-2,3-dihydroindol-1-yl)benzonitrile |
| SMILES | CC1Cc2ccccc2N1c1ccc(C#N)c(Cl)c1 |
| InChI | InChI=1S/C16H13ClN2/c1-11-8-12-4-2-3-5-16(12)19(11)14-7-6-13(10-18)15(17)9-14/h2-7,9,11H,8H2,1H3 |
| InChIKey | FOCYFBBSYMOAOG-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.75 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |