C16H13FN2 — CID 102815035
3-fluoro-5-(2-methyl-2,3-dihydroindol-1-yl)benzonitrile (PubChem CID 102815035) has the molecular formula C16H13FN2 and a molecular weight of 252.29 g/mol. Its IUPAC name is 3-fluoro-5-(2-methyl-2,3-dihydroindol-1-yl)benzonitrile.
| Compound Name | 3-fluoro-5-(2-methyl-2,3-dihydroindol-1-yl)benzonitrile |
|---|---|
| PubChem CID | 102815035 |
| Molecular Formula | C16H13FN2 |
| Molecular Weight | 252.29 g/mol |
| Exact Mass | 252.11 |
| IUPAC Name | 3-fluoro-5-(2-methyl-2,3-dihydroindol-1-yl)benzonitrile |
| SMILES | CC1Cc2ccccc2N1c1cc(F)cc(C#N)c1 |
| InChI | InChI=1S/C16H13FN2/c1-11-6-13-4-2-3-5-16(13)19(11)15-8-12(10-18)7-14(17)9-15/h2-5,7-9,11H,6H2,1H3 |
| InChIKey | FFEZSZJXDHTFBC-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.29 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |