C16H14F2N2S — CID 81286903
3,5-difluoro-4-(2-methyl-2,3-dihydroindol-1-yl)benzenecarbothioamide (PubChem CID 81286903) has the molecular formula C16H14F2N2S and a molecular weight of 304.37 g/mol. Its IUPAC name is 3,5-difluoro-4-(2-methyl-2,3-dihydroindol-1-yl)benzenecarbothioamide.
| Compound Name | 3,5-difluoro-4-(2-methyl-2,3-dihydroindol-1-yl)benzenecarbothioamide |
|---|---|
| PubChem CID | 81286903 |
| Molecular Formula | C16H14F2N2S |
| Molecular Weight | 304.37 g/mol |
| Exact Mass | 304.08 |
| IUPAC Name | 3,5-difluoro-4-(2-methyl-2,3-dihydroindol-1-yl)benzenecarbothioamide |
| SMILES | CC1Cc2ccccc2N1c1c(F)cc(C(N)=S)cc1F |
| InChI | InChI=1S/C16H14F2N2S/c1-9-6-10-4-2-3-5-14(10)20(9)15-12(17)7-11(16(19)21)8-13(15)18/h2-5,7-9H,6H2,1H3,(H2,19,21) |
| InChIKey | ZYDCZMOJRHXZDF-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.37 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|