C15H15N3S — CID 115488133
5-(2-methyl-2,3-dihydroindol-1-yl)pyridine-2-carbothioamide (PubChem CID 115488133) has the molecular formula C15H15N3S and a molecular weight of 269.37 g/mol. Its IUPAC name is 5-(2-methyl-2,3-dihydroindol-1-yl)pyridine-2-carbothioamide.
| Compound Name | 5-(2-methyl-2,3-dihydroindol-1-yl)pyridine-2-carbothioamide |
|---|---|
| PubChem CID | 115488133 |
| Molecular Formula | C15H15N3S |
| Molecular Weight | 269.37 g/mol |
| Exact Mass | 269.10 |
| IUPAC Name | 5-(2-methyl-2,3-dihydroindol-1-yl)pyridine-2-carbothioamide |
| SMILES | CC1Cc2ccccc2N1c1ccc(C(N)=S)nc1 |
| InChI | InChI=1S/C15H15N3S/c1-10-8-11-4-2-3-5-14(11)18(10)12-6-7-13(15(16)19)17-9-12/h2-7,9-10H,8H2,1H3,(H2,16,19) |
| InChIKey | JEPUKWFDOVIHKR-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.37 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|