C15H15FN2 — CID 55067818
4-fluoro-2-(2-methyl-2,3-dihydroindol-1-yl)aniline (PubChem CID 55067818) has the molecular formula C15H15FN2 and a molecular weight of 242.30 g/mol. Its IUPAC name is 4-fluoro-2-(2-methyl-2,3-dihydroindol-1-yl)aniline.
| Compound Name | 4-fluoro-2-(2-methyl-2,3-dihydroindol-1-yl)aniline |
|---|---|
| PubChem CID | 55067818 |
| Molecular Formula | C15H15FN2 |
| Molecular Weight | 242.30 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | 4-fluoro-2-(2-methyl-2,3-dihydroindol-1-yl)aniline |
| SMILES | CC1Cc2ccccc2N1c1cc(F)ccc1N |
| InChI | InChI=1S/C15H15FN2/c1-10-8-11-4-2-3-5-14(11)18(10)15-9-12(16)6-7-13(15)17/h2-7,9-10H,8,17H2,1H3 |
| InChIKey | TWYGIWOAMHUCDI-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.30 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|