About [2,3-difluoro-4-(2-methyl-2,3-dihydroindol-1-yl)phenyl]methanamine
[2,3-difluoro-4-(2-methyl-2,3-dihydroindol-1-yl)phenyl]methanamine (PubChem CID 107932681) has the molecular formula C16H16F2N2
and a molecular weight of 274.31 g/mol. Its IUPAC name is [2,3-difluoro-4-(2-methyl-2,3-dihydroindol-1-yl)phenyl]methanamine.
Molecular Properties
| Compound Name | [2,3-difluoro-4-(2-methyl-2,3-dihydroindol-1-yl)phenyl]methanamine |
| PubChem CID | 107932681 |
| Molecular Formula | C16H16F2N2 |
| Molecular Weight | 274.31 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | [2,3-difluoro-4-(2-methyl-2,3-dihydroindol-1-yl)phenyl]methanamine |
| SMILES | CC1Cc2ccccc2N1c1ccc(CN)c(F)c1F |
| InChI | InChI=1S/C16H16F2N2/c1-10-8-11-4-2-3-5-13(11)20(10)14-7-6-12(9-19)15(17)16(14)18/h2-7,10H,8-9,19H2,1H3 |
| InChIKey | MPJZLECTZDQERE-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.31 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [2,3-difluoro-4-(2-methyl-2,3-dihydroindol-1-yl)phenyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,3-difluoro-4-(2-methyl-2,3-dihydroindol-1-yl)phenyl]methanamine?
The IUPAC name of [2,3-difluoro-4-(2-methyl-2,3-dihydroindol-1-yl)phenyl]methanamine (CID 107932681) is [2,3-difluoro-4-(2-methyl-2,3-dihydroindol-1-yl)phenyl]methanamine.
What is the SMILES notation for [2,3-difluoro-4-(2-methyl-2,3-dihydroindol-1-yl)phenyl]methanamine?
The canonical SMILES for [2,3-difluoro-4-(2-methyl-2,3-dihydroindol-1-yl)phenyl]methanamine is CC1Cc2ccccc2N1c1ccc(CN)c(F)c1F.
What is the InChIKey of [2,3-difluoro-4-(2-methyl-2,3-dihydroindol-1-yl)phenyl]methanamine?
The InChIKey is MPJZLECTZDQERE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16F2N2/c1-10-8-11-4-2-3-5-13(11)20(10)14-7-6-12(9-19)15(17)16(14)18/h2-7,10H,8-9,19H2,1H3.
What are the key properties of [2,3-difluoro-4-(2-methyl-2,3-dihydroindol-1-yl)phenyl]methanamine?
[2,3-difluoro-4-(2-methyl-2,3-dihydroindol-1-yl)phenyl]methanamine has a molecular weight of 274.31 g/mol, XLogP of 3.51, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [2,3-difluoro-4-(2-methyl-2,3-dihydroindol-1-yl)phenyl]methanamine is sourced from PubChem (CID 107932681), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).