C13H11ClN2OS — CID 80687417
4-chloro-2-(2-methyl-2,3-dihydroindol-1-yl)-1,3-thiazole-5-carbaldehyde (PubChem CID 80687417) has the molecular formula C13H11ClN2OS and a molecular weight of 278.76 g/mol. Its IUPAC name is 4-chloro-2-(2-methyl-2,3-dihydroindol-1-yl)-1,3-thiazole-5-carbaldehyde.
| Compound Name | 4-chloro-2-(2-methyl-2,3-dihydroindol-1-yl)-1,3-thiazole-5-carbaldehyde |
|---|---|
| PubChem CID | 80687417 |
| Molecular Formula | C13H11ClN2OS |
| Molecular Weight | 278.76 g/mol |
| Exact Mass | 278.03 |
| IUPAC Name | 4-chloro-2-(2-methyl-2,3-dihydroindol-1-yl)-1,3-thiazole-5-carbaldehyde |
| SMILES | CC1Cc2ccccc2N1c1nc(Cl)c(C=O)s1 |
| InChI | InChI=1S/C13H11ClN2OS/c1-8-6-9-4-2-3-5-10(9)16(8)13-15-12(14)11(7-17)18-13/h2-5,7-8H,6H2,1H3 |
| InChIKey | JXACKWYDZLRUCZ-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.76 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|