C11H13Cl3N2O — CID 102750334
2,3,5-trichloro-6-(4-methoxypiperidin-1-yl)pyridine (PubChem CID 102750334) has the molecular formula C11H13Cl3N2O and a molecular weight of 295.60 g/mol. Its IUPAC name is 2,3,5-trichloro-6-(4-methoxypiperidin-1-yl)pyridine.
| Compound Name | 2,3,5-trichloro-6-(4-methoxypiperidin-1-yl)pyridine |
|---|---|
| PubChem CID | 102750334 |
| Molecular Formula | C11H13Cl3N2O |
| Molecular Weight | 295.60 g/mol |
| Exact Mass | 294.01 |
| IUPAC Name | 2,3,5-trichloro-6-(4-methoxypiperidin-1-yl)pyridine |
| SMILES | COC1CCN(c2nc(Cl)c(Cl)cc2Cl)CC1 |
| InChI | InChI=1S/C11H13Cl3N2O/c1-17-7-2-4-16(5-3-7)11-9(13)6-8(12)10(14)15-11/h6-7H,2-5H2,1H3 |
| InChIKey | ZFQWWSZMDMQVKW-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.60 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|