C11H17ClN4 — CID 106812346
5-chloro-6-(3,4-dimethylpiperidin-1-yl)pyrimidin-4-amine (PubChem CID 106812346) has the molecular formula C11H17ClN4 and a molecular weight of 240.74 g/mol. Its IUPAC name is 5-chloro-6-(3,4-dimethylpiperidin-1-yl)pyrimidin-4-amine.
| Compound Name | 5-chloro-6-(3,4-dimethylpiperidin-1-yl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 106812346 |
| Molecular Formula | C11H17ClN4 |
| Molecular Weight | 240.74 g/mol |
| Exact Mass | 240.11 |
| IUPAC Name | 5-chloro-6-(3,4-dimethylpiperidin-1-yl)pyrimidin-4-amine |
| SMILES | CC1CCN(c2ncnc(N)c2Cl)CC1C |
| InChI | InChI=1S/C11H17ClN4/c1-7-3-4-16(5-8(7)2)11-9(12)10(13)14-6-15-11/h6-8H,3-5H2,1-2H3,(H2,13,14,15) |
| InChIKey | NXZCTWWDEYLYOR-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.74 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |