C9H13ClN4S — CID 106812004
5-chloro-6-(2-methylthiomorpholin-4-yl)pyrimidin-4-amine (PubChem CID 106812004) has the molecular formula C9H13ClN4S and a molecular weight of 244.75 g/mol. Its IUPAC name is 5-chloro-6-(2-methylthiomorpholin-4-yl)pyrimidin-4-amine.
| Compound Name | 5-chloro-6-(2-methylthiomorpholin-4-yl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 106812004 |
| Molecular Formula | C9H13ClN4S |
| Molecular Weight | 244.75 g/mol |
| Exact Mass | 244.05 |
| IUPAC Name | 5-chloro-6-(2-methylthiomorpholin-4-yl)pyrimidin-4-amine |
| SMILES | CC1CN(c2ncnc(N)c2Cl)CCS1 |
| InChI | InChI=1S/C9H13ClN4S/c1-6-4-14(2-3-15-6)9-7(10)8(11)12-5-13-9/h5-6H,2-4H2,1H3,(H2,11,12,13) |
| InChIKey | DNWCMQPFIKZRTH-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.75 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |