C11H15ClN4O2 — CID 114049878
methyl 1-(6-amino-5-chloropyrimidin-4-yl)piperidine-3-carboxylate (PubChem CID 114049878) has the molecular formula C11H15ClN4O2 and a molecular weight of 270.72 g/mol. Its IUPAC name is methyl 1-(6-amino-5-chloropyrimidin-4-yl)piperidine-3-carboxylate.
| Compound Name | methyl 1-(6-amino-5-chloropyrimidin-4-yl)piperidine-3-carboxylate |
|---|---|
| PubChem CID | 114049878 |
| Molecular Formula | C11H15ClN4O2 |
| Molecular Weight | 270.72 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | methyl 1-(6-amino-5-chloropyrimidin-4-yl)piperidine-3-carboxylate |
| SMILES | COC(=O)C1CCCN(c2ncnc(N)c2Cl)C1 |
| InChI | InChI=1S/C11H15ClN4O2/c1-18-11(17)7-3-2-4-16(5-7)10-8(12)9(13)14-6-15-10/h6-7H,2-5H2,1H3,(H2,13,14,15) |
| InChIKey | VNUKRHRZLXGWTI-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 81.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.72 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |