C11H14ClN3O2 — CID 105370413
methyl 1-(5-chloropyrimidin-4-yl)piperidine-3-carboxylate (PubChem CID 105370413) has the molecular formula C11H14ClN3O2 and a molecular weight of 255.70 g/mol. Its IUPAC name is methyl 1-(5-chloropyrimidin-4-yl)piperidine-3-carboxylate.
| Compound Name | methyl 1-(5-chloropyrimidin-4-yl)piperidine-3-carboxylate |
|---|---|
| PubChem CID | 105370413 |
| Molecular Formula | C11H14ClN3O2 |
| Molecular Weight | 255.70 g/mol |
| Exact Mass | 255.08 |
| IUPAC Name | methyl 1-(5-chloropyrimidin-4-yl)piperidine-3-carboxylate |
| SMILES | COC(=O)C1CCCN(c2ncncc2Cl)C1 |
| InChI | InChI=1S/C11H14ClN3O2/c1-17-11(16)8-3-2-4-15(6-8)10-9(12)5-13-7-14-10/h5,7-8H,2-4,6H2,1H3 |
| InChIKey | DPMSPPWXAFYQGY-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.70 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |