About methyl (3R)-1-(2,5-dimethylthieno[2,3-d]pyrimidin-4-yl)piperidine-3-carboxylate
methyl (3R)-1-(2,5-dimethylthieno[2,3-d]pyrimidin-4-yl)piperidine-3-carboxylate (PubChem CID 133484605) has the molecular formula C15H19N3O2S
and a molecular weight of 305.40 g/mol. Its IUPAC name is methyl (3R)-1-(2,5-dimethylthieno[2,3-d]pyrimidin-4-yl)piperidine-3-carboxylate.
Molecular Properties
| Compound Name | methyl (3R)-1-(2,5-dimethylthieno[2,3-d]pyrimidin-4-yl)piperidine-3-carboxylate |
| PubChem CID | 133484605 |
| Molecular Formula | C15H19N3O2S |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | methyl (3R)-1-(2,5-dimethylthieno[2,3-d]pyrimidin-4-yl)piperidine-3-carboxylate |
| SMILES | COC(=O)[C@@H]1CCCN(c2nc(C)nc3scc(C)c23)C1 |
| InChI | InChI=1S/C15H19N3O2S/c1-9-8-21-14-12(9)13(16-10(2)17-14)18-6-4-5-11(7-18)15(19)20-3/h8,11H,4-7H2,1-3H3/t11-/m1/s1 |
| InChIKey | CJXBTGWOLRZMRZ-LLVKDONJSA-N |
| XLogP | 2.70 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl (3R)-1-(2,5-dimethylthieno[2,3-d]pyrimidin-4-yl)piperidine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (3R)-1-(2,5-dimethylthieno[2,3-d]pyrimidin-4-yl)piperidine-3-carboxylate?
The IUPAC name of methyl (3R)-1-(2,5-dimethylthieno[2,3-d]pyrimidin-4-yl)piperidine-3-carboxylate (CID 133484605) is methyl (3R)-1-(2,5-dimethylthieno[2,3-d]pyrimidin-4-yl)piperidine-3-carboxylate.
What is the SMILES notation for methyl (3R)-1-(2,5-dimethylthieno[2,3-d]pyrimidin-4-yl)piperidine-3-carboxylate?
The canonical SMILES for methyl (3R)-1-(2,5-dimethylthieno[2,3-d]pyrimidin-4-yl)piperidine-3-carboxylate is COC(=O)[C@@H]1CCCN(c2nc(C)nc3scc(C)c23)C1.
What is the InChIKey of methyl (3R)-1-(2,5-dimethylthieno[2,3-d]pyrimidin-4-yl)piperidine-3-carboxylate?
The InChIKey is CJXBTGWOLRZMRZ-LLVKDONJSA-N. The full InChI is InChI=1S/C15H19N3O2S/c1-9-8-21-14-12(9)13(16-10(2)17-14)18-6-4-5-11(7-18)15(19)20-3/h8,11H,4-7H2,1-3H3/t11-/m1/s1.
What are the key properties of methyl (3R)-1-(2,5-dimethylthieno[2,3-d]pyrimidin-4-yl)piperidine-3-carboxylate?
methyl (3R)-1-(2,5-dimethylthieno[2,3-d]pyrimidin-4-yl)piperidine-3-carboxylate has a molecular weight of 305.40 g/mol, XLogP of 2.70, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (3R)-1-(2,5-dimethylthieno[2,3-d]pyrimidin-4-yl)piperidine-3-carboxylate is sourced from PubChem (CID 133484605), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).