About methyl 1-[5-(3,5-dimethylpiperidin-1-yl)quinazolin-4-yl]piperidine-3-carboxylate
methyl 1-[5-(3,5-dimethylpiperidin-1-yl)quinazolin-4-yl]piperidine-3-carboxylate (PubChem CID 134211180) has the molecular formula C22H30N4O2
and a molecular weight of 382.51 g/mol. Its IUPAC name is methyl 1-[5-(3,5-dimethylpiperidin-1-yl)quinazolin-4-yl]piperidine-3-carboxylate.
Molecular Properties
| Compound Name | methyl 1-[5-(3,5-dimethylpiperidin-1-yl)quinazolin-4-yl]piperidine-3-carboxylate |
| PubChem CID | 134211180 |
| Molecular Formula | C22H30N4O2 |
| Molecular Weight | 382.51 g/mol |
| Exact Mass | 382.24 |
| IUPAC Name | methyl 1-[5-(3,5-dimethylpiperidin-1-yl)quinazolin-4-yl]piperidine-3-carboxylate |
| SMILES | COC(=O)C1CCCN(c2ncnc3cccc(N4CC(C)CC(C)C4)c23)C1 |
| InChI | InChI=1S/C22H30N4O2/c1-15-10-16(2)12-26(11-15)19-8-4-7-18-20(19)21(24-14-23-18)25-9-5-6-17(13-25)22(27)28-3/h4,7-8,14-17H,5-6,9-13H2,1-3H3 |
| InChIKey | PSGKGNSDRQCWHD-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.51 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 1-[5-(3,5-dimethylpiperidin-1-yl)quinazolin-4-yl]piperidine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 1-[5-(3,5-dimethylpiperidin-1-yl)quinazolin-4-yl]piperidine-3-carboxylate?
The IUPAC name of methyl 1-[5-(3,5-dimethylpiperidin-1-yl)quinazolin-4-yl]piperidine-3-carboxylate (CID 134211180) is methyl 1-[5-(3,5-dimethylpiperidin-1-yl)quinazolin-4-yl]piperidine-3-carboxylate.
What is the SMILES notation for methyl 1-[5-(3,5-dimethylpiperidin-1-yl)quinazolin-4-yl]piperidine-3-carboxylate?
The canonical SMILES for methyl 1-[5-(3,5-dimethylpiperidin-1-yl)quinazolin-4-yl]piperidine-3-carboxylate is COC(=O)C1CCCN(c2ncnc3cccc(N4CC(C)CC(C)C4)c23)C1.
What is the InChIKey of methyl 1-[5-(3,5-dimethylpiperidin-1-yl)quinazolin-4-yl]piperidine-3-carboxylate?
The InChIKey is PSGKGNSDRQCWHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H30N4O2/c1-15-10-16(2)12-26(11-15)19-8-4-7-18-20(19)21(24-14-23-18)25-9-5-6-17(13-25)22(27)28-3/h4,7-8,14-17H,5-6,9-13H2,1-3H3.
What are the key properties of methyl 1-[5-(3,5-dimethylpiperidin-1-yl)quinazolin-4-yl]piperidine-3-carboxylate?
methyl 1-[5-(3,5-dimethylpiperidin-1-yl)quinazolin-4-yl]piperidine-3-carboxylate has a molecular weight of 382.51 g/mol, XLogP of 3.50, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-[5-(3,5-dimethylpiperidin-1-yl)quinazolin-4-yl]piperidine-3-carboxylate is sourced from PubChem (CID 134211180), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).