C13H19ClN2OS — CID 80687435
4-chloro-2-(4-propylazepan-1-yl)-1,3-thiazole-5-carbaldehyde (PubChem CID 80687435) has the molecular formula C13H19ClN2OS and a molecular weight of 286.83 g/mol. Its IUPAC name is 4-chloro-2-(4-propylazepan-1-yl)-1,3-thiazole-5-carbaldehyde.
| Compound Name | 4-chloro-2-(4-propylazepan-1-yl)-1,3-thiazole-5-carbaldehyde |
|---|---|
| PubChem CID | 80687435 |
| Molecular Formula | C13H19ClN2OS |
| Molecular Weight | 286.83 g/mol |
| Exact Mass | 286.09 |
| IUPAC Name | 4-chloro-2-(4-propylazepan-1-yl)-1,3-thiazole-5-carbaldehyde |
| SMILES | CCCC1CCCN(c2nc(Cl)c(C=O)s2)CC1 |
| InChI | InChI=1S/C13H19ClN2OS/c1-2-4-10-5-3-7-16(8-6-10)13-15-12(14)11(9-17)18-13/h9-10H,2-8H2,1H3 |
| InChIKey | JODRFQCOIDOVOW-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.83 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|