C12H15ClN2O3S — CID 53273642
ethyl 1-(4-chloro-5-formyl-1,3-thiazol-2-yl)piperidine-3-carboxylate (PubChem CID 53273642) has the molecular formula C12H15ClN2O3S and a molecular weight of 302.78 g/mol. Its IUPAC name is ethyl 1-(4-chloro-5-formyl-1,3-thiazol-2-yl)piperidine-3-carboxylate.
| Compound Name | ethyl 1-(4-chloro-5-formyl-1,3-thiazol-2-yl)piperidine-3-carboxylate |
|---|---|
| PubChem CID | 53273642 |
| Molecular Formula | C12H15ClN2O3S |
| Molecular Weight | 302.78 g/mol |
| Exact Mass | 302.05 |
| IUPAC Name | ethyl 1-(4-chloro-5-formyl-1,3-thiazol-2-yl)piperidine-3-carboxylate |
| SMILES | CCOC(=O)C1CCCN(c2nc(Cl)c(C=O)s2)C1 |
| InChI | InChI=1S/C12H15ClN2O3S/c1-2-18-11(17)8-4-3-5-15(6-8)12-14-10(13)9(7-16)19-12/h7-8H,2-6H2,1H3 |
| InChIKey | OJMCVFPZCREDRM-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.78 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|