C15H17ClN2O2S — CID 67454156
ethyl (3R)-1-(6-chloro-1,3-benzothiazol-2-yl)piperidine-3-carboxylate (PubChem CID 67454156) has the molecular formula C15H17ClN2O2S and a molecular weight of 324.83 g/mol. Its IUPAC name is ethyl (3R)-1-(6-chloro-1,3-benzothiazol-2-yl)piperidine-3-carboxylate.
| Compound Name | ethyl (3R)-1-(6-chloro-1,3-benzothiazol-2-yl)piperidine-3-carboxylate |
|---|---|
| PubChem CID | 67454156 |
| Molecular Formula | C15H17ClN2O2S |
| Molecular Weight | 324.83 g/mol |
| Exact Mass | 324.07 |
| IUPAC Name | ethyl (3R)-1-(6-chloro-1,3-benzothiazol-2-yl)piperidine-3-carboxylate |
| SMILES | CCOC(=O)[C@@H]1CCCN(c2nc3ccc(Cl)cc3s2)C1 |
| InChI | InChI=1S/C15H17ClN2O2S/c1-2-20-14(19)10-4-3-7-18(9-10)15-17-12-6-5-11(16)8-13(12)21-15/h5-6,8,10H,2-4,7,9H2,1H3/t10-/m1/s1 |
| InChIKey | XRNTWGQTUXRAMR-SNVBAGLBSA-N |
| XLogP | 3.73 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.83 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |