C14H22ClN3O2S — CID 64601309
3-chloro-N-methyl-5-(4-propylpiperidin-1-yl)sulfonylpyridin-2-amine (PubChem CID 64601309) has the molecular formula C14H22ClN3O2S and a molecular weight of 331.87 g/mol. Its IUPAC name is 3-chloro-N-methyl-5-(4-propylpiperidin-1-yl)sulfonylpyridin-2-amine.
| Compound Name | 3-chloro-N-methyl-5-(4-propylpiperidin-1-yl)sulfonylpyridin-2-amine |
|---|---|
| PubChem CID | 64601309 |
| Molecular Formula | C14H22ClN3O2S |
| Molecular Weight | 331.87 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | 3-chloro-N-methyl-5-(4-propylpiperidin-1-yl)sulfonylpyridin-2-amine |
| SMILES | CCCC1CCN(S(=O)(=O)c2cnc(NC)c(Cl)c2)CC1 |
| InChI | InChI=1S/C14H22ClN3O2S/c1-3-4-11-5-7-18(8-6-11)21(19,20)12-9-13(15)14(16-2)17-10-12/h9-11H,3-8H2,1-2H3,(H,16,17) |
| InChIKey | DDHOODGKXCGGMF-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.87 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |