About 3-chloro-5-[(1,1-dioxo-1,4-thiazinan-4-yl)sulfonyl]-N-methylpyridin-2-amine
3-chloro-5-[(1,1-dioxo-1,4-thiazinan-4-yl)sulfonyl]-N-methylpyridin-2-amine (PubChem CID 64602625) has the molecular formula C10H14ClN3O4S2
and a molecular weight of 339.83 g/mol. Its IUPAC name is 3-chloro-5-[(1,1-dioxo-1,4-thiazinan-4-yl)sulfonyl]-N-methylpyridin-2-amine.
Molecular Properties
| Compound Name | 3-chloro-5-[(1,1-dioxo-1,4-thiazinan-4-yl)sulfonyl]-N-methylpyridin-2-amine |
| PubChem CID | 64602625 |
| Molecular Formula | C10H14ClN3O4S2 |
| Molecular Weight | 339.83 g/mol |
| Exact Mass | 339.01 |
| IUPAC Name | 3-chloro-5-[(1,1-dioxo-1,4-thiazinan-4-yl)sulfonyl]-N-methylpyridin-2-amine |
| SMILES | CNc1ncc(S(=O)(=O)N2CCS(=O)(=O)CC2)cc1Cl |
| InChI | InChI=1S/C10H14ClN3O4S2/c1-12-10-9(11)6-8(7-13-10)20(17,18)14-2-4-19(15,16)5-3-14/h6-7H,2-5H2,1H3,(H,12,13) |
| InChIKey | ZJQPWGIHQMEBLY-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 96.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.83 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-chloro-5-[(1,1-dioxo-1,4-thiazinan-4-yl)sulfonyl]-N-methylpyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-5-[(1,1-dioxo-1,4-thiazinan-4-yl)sulfonyl]-N-methylpyridin-2-amine?
The IUPAC name of 3-chloro-5-[(1,1-dioxo-1,4-thiazinan-4-yl)sulfonyl]-N-methylpyridin-2-amine (CID 64602625) is 3-chloro-5-[(1,1-dioxo-1,4-thiazinan-4-yl)sulfonyl]-N-methylpyridin-2-amine.
What is the SMILES notation for 3-chloro-5-[(1,1-dioxo-1,4-thiazinan-4-yl)sulfonyl]-N-methylpyridin-2-amine?
The canonical SMILES for 3-chloro-5-[(1,1-dioxo-1,4-thiazinan-4-yl)sulfonyl]-N-methylpyridin-2-amine is CNc1ncc(S(=O)(=O)N2CCS(=O)(=O)CC2)cc1Cl.
What is the InChIKey of 3-chloro-5-[(1,1-dioxo-1,4-thiazinan-4-yl)sulfonyl]-N-methylpyridin-2-amine?
The InChIKey is ZJQPWGIHQMEBLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14ClN3O4S2/c1-12-10-9(11)6-8(7-13-10)20(17,18)14-2-4-19(15,16)5-3-14/h6-7H,2-5H2,1H3,(H,12,13).
What are the key properties of 3-chloro-5-[(1,1-dioxo-1,4-thiazinan-4-yl)sulfonyl]-N-methylpyridin-2-amine?
3-chloro-5-[(1,1-dioxo-1,4-thiazinan-4-yl)sulfonyl]-N-methylpyridin-2-amine has a molecular weight of 339.83 g/mol, XLogP of 0.20, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-5-[(1,1-dioxo-1,4-thiazinan-4-yl)sulfonyl]-N-methylpyridin-2-amine is sourced from PubChem (CID 64602625), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).