C11H17ClN4O2S — CID 79180624
[3-chloro-5-(3,4-dimethylpyrrolidin-1-yl)sulfonyl-2-pyridinyl]hydrazine (PubChem CID 79180624) has the molecular formula C11H17ClN4O2S and a molecular weight of 304.80 g/mol. Its IUPAC name is [3-chloro-5-(3,4-dimethylpyrrolidin-1-yl)sulfonyl-2-pyridinyl]hydrazine.
| Compound Name | [3-chloro-5-(3,4-dimethylpyrrolidin-1-yl)sulfonyl-2-pyridinyl]hydrazine |
|---|---|
| PubChem CID | 79180624 |
| Molecular Formula | C11H17ClN4O2S |
| Molecular Weight | 304.80 g/mol |
| Exact Mass | 304.08 |
| IUPAC Name | [3-chloro-5-(3,4-dimethylpyrrolidin-1-yl)sulfonyl-2-pyridinyl]hydrazine |
| SMILES | CC1CN(S(=O)(=O)c2cnc(NN)c(Cl)c2)CC1C |
| InChI | InChI=1S/C11H17ClN4O2S/c1-7-5-16(6-8(7)2)19(17,18)9-3-10(12)11(15-13)14-4-9/h3-4,7-8H,5-6,13H2,1-2H3,(H,14,15) |
| InChIKey | YPFYCTKABBMGEC-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.80 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|