C11H16ClN3O2S2 — CID 64600747
3-chloro-N-methyl-5-(3-methylthiomorpholin-4-yl)sulfonylpyridin-2-amine (PubChem CID 64600747) has the molecular formula C11H16ClN3O2S2 and a molecular weight of 321.86 g/mol. Its IUPAC name is 3-chloro-N-methyl-5-(3-methylthiomorpholin-4-yl)sulfonylpyridin-2-amine.
| Compound Name | 3-chloro-N-methyl-5-(3-methylthiomorpholin-4-yl)sulfonylpyridin-2-amine |
|---|---|
| PubChem CID | 64600747 |
| Molecular Formula | C11H16ClN3O2S2 |
| Molecular Weight | 321.86 g/mol |
| Exact Mass | 321.04 |
| IUPAC Name | 3-chloro-N-methyl-5-(3-methylthiomorpholin-4-yl)sulfonylpyridin-2-amine |
| SMILES | CNc1ncc(S(=O)(=O)N2CCSCC2C)cc1Cl |
| InChI | InChI=1S/C11H16ClN3O2S2/c1-8-7-18-4-3-15(8)19(16,17)9-5-10(12)11(13-2)14-6-9/h5-6,8H,3-4,7H2,1-2H3,(H,13,14) |
| InChIKey | WZMPWNPHTGYIJO-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.86 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |