C12H13ClN2O2S2 — CID 112692419
2-chloro-4-(3-methylthiomorpholin-4-yl)sulfonylbenzonitrile (PubChem CID 112692419) has the molecular formula C12H13ClN2O2S2 and a molecular weight of 316.84 g/mol. Its IUPAC name is 2-chloro-4-(3-methylthiomorpholin-4-yl)sulfonylbenzonitrile.
| Compound Name | 2-chloro-4-(3-methylthiomorpholin-4-yl)sulfonylbenzonitrile |
|---|---|
| PubChem CID | 112692419 |
| Molecular Formula | C12H13ClN2O2S2 |
| Molecular Weight | 316.84 g/mol |
| Exact Mass | 316.01 |
| IUPAC Name | 2-chloro-4-(3-methylthiomorpholin-4-yl)sulfonylbenzonitrile |
| SMILES | CC1CSCCN1S(=O)(=O)c1ccc(C#N)c(Cl)c1 |
| InChI | InChI=1S/C12H13ClN2O2S2/c1-9-8-18-5-4-15(9)19(16,17)11-3-2-10(7-14)12(13)6-11/h2-3,6,9H,4-5,8H2,1H3 |
| InChIKey | NJIMUCBMSBIDSC-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.84 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |