C13H15ClN2O2S — CID 112689420
2-chloro-4-(2,2-dimethylpyrrolidin-1-yl)sulfonylbenzonitrile (PubChem CID 112689420) has the molecular formula C13H15ClN2O2S and a molecular weight of 298.80 g/mol. Its IUPAC name is 2-chloro-4-(2,2-dimethylpyrrolidin-1-yl)sulfonylbenzonitrile.
| Compound Name | 2-chloro-4-(2,2-dimethylpyrrolidin-1-yl)sulfonylbenzonitrile |
|---|---|
| PubChem CID | 112689420 |
| Molecular Formula | C13H15ClN2O2S |
| Molecular Weight | 298.80 g/mol |
| Exact Mass | 298.05 |
| IUPAC Name | 2-chloro-4-(2,2-dimethylpyrrolidin-1-yl)sulfonylbenzonitrile |
| SMILES | CC1(C)CCCN1S(=O)(=O)c1ccc(C#N)c(Cl)c1 |
| InChI | InChI=1S/C13H15ClN2O2S/c1-13(2)6-3-7-16(13)19(17,18)11-5-4-10(9-15)12(14)8-11/h4-5,8H,3,6-7H2,1-2H3 |
| InChIKey | WUHAUTCDYDXLMY-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.80 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |