C13H15ClN2O3S — CID 115582140
2-chloro-4-(2,2-dimethylmorpholin-4-yl)sulfonylbenzonitrile (PubChem CID 115582140) has the molecular formula C13H15ClN2O3S and a molecular weight of 314.79 g/mol. Its IUPAC name is 2-chloro-4-(2,2-dimethylmorpholin-4-yl)sulfonylbenzonitrile.
| Compound Name | 2-chloro-4-(2,2-dimethylmorpholin-4-yl)sulfonylbenzonitrile |
|---|---|
| PubChem CID | 115582140 |
| Molecular Formula | C13H15ClN2O3S |
| Molecular Weight | 314.79 g/mol |
| Exact Mass | 314.05 |
| IUPAC Name | 2-chloro-4-(2,2-dimethylmorpholin-4-yl)sulfonylbenzonitrile |
| SMILES | CC1(C)CN(S(=O)(=O)c2ccc(C#N)c(Cl)c2)CCO1 |
| InChI | InChI=1S/C13H15ClN2O3S/c1-13(2)9-16(5-6-19-13)20(17,18)11-4-3-10(8-15)12(14)7-11/h3-4,7H,5-6,9H2,1-2H3 |
| InChIKey | RXHUECXAMPCBKE-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 70.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.79 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |