C13H19ClN2O3S — CID 43592447
3-chloro-5-(2,2-dimethylmorpholin-4-yl)sulfonyl-2-methylaniline (PubChem CID 43592447) has the molecular formula C13H19ClN2O3S and a molecular weight of 318.83 g/mol. Its IUPAC name is 3-chloro-5-(2,2-dimethylmorpholin-4-yl)sulfonyl-2-methylaniline.
| Compound Name | 3-chloro-5-(2,2-dimethylmorpholin-4-yl)sulfonyl-2-methylaniline |
|---|---|
| PubChem CID | 43592447 |
| Molecular Formula | C13H19ClN2O3S |
| Molecular Weight | 318.83 g/mol |
| Exact Mass | 318.08 |
| IUPAC Name | 3-chloro-5-(2,2-dimethylmorpholin-4-yl)sulfonyl-2-methylaniline |
| SMILES | Cc1c(N)cc(S(=O)(=O)N2CCOC(C)(C)C2)cc1Cl |
| InChI | InChI=1S/C13H19ClN2O3S/c1-9-11(14)6-10(7-12(9)15)20(17,18)16-4-5-19-13(2,3)8-16/h6-7H,4-5,8,15H2,1-3H3 |
| InChIKey | DWZNTXDUDKKIQN-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.83 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|