C14H21FN2O3S — CID 107325666
3-(2,2-dimethylmorpholin-4-yl)sulfonyl-6-fluoro-2,4-dimethylaniline (PubChem CID 107325666) has the molecular formula C14H21FN2O3S and a molecular weight of 316.40 g/mol. Its IUPAC name is 3-(2,2-dimethylmorpholin-4-yl)sulfonyl-6-fluoro-2,4-dimethylaniline.
| Compound Name | 3-(2,2-dimethylmorpholin-4-yl)sulfonyl-6-fluoro-2,4-dimethylaniline |
|---|---|
| PubChem CID | 107325666 |
| Molecular Formula | C14H21FN2O3S |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | 3-(2,2-dimethylmorpholin-4-yl)sulfonyl-6-fluoro-2,4-dimethylaniline |
| SMILES | Cc1cc(F)c(N)c(C)c1S(=O)(=O)N1CCOC(C)(C)C1 |
| InChI | InChI=1S/C14H21FN2O3S/c1-9-7-11(15)12(16)10(2)13(9)21(18,19)17-5-6-20-14(3,4)8-17/h7H,5-6,8,16H2,1-4H3 |
| InChIKey | JBYVQTUAPBQMST-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|