C14H20FNO3S — CID 107326755
4-(4-fluoro-2,6-dimethylphenyl)sulfonyl-2,2-dimethylmorpholine (PubChem CID 107326755) has the molecular formula C14H20FNO3S and a molecular weight of 301.38 g/mol. Its IUPAC name is 4-(4-fluoro-2,6-dimethylphenyl)sulfonyl-2,2-dimethylmorpholine.
| Compound Name | 4-(4-fluoro-2,6-dimethylphenyl)sulfonyl-2,2-dimethylmorpholine |
|---|---|
| PubChem CID | 107326755 |
| Molecular Formula | C14H20FNO3S |
| Molecular Weight | 301.38 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | 4-(4-fluoro-2,6-dimethylphenyl)sulfonyl-2,2-dimethylmorpholine |
| SMILES | Cc1cc(F)cc(C)c1S(=O)(=O)N1CCOC(C)(C)C1 |
| InChI | InChI=1S/C14H20FNO3S/c1-10-7-12(15)8-11(2)13(10)20(17,18)16-5-6-19-14(3,4)9-16/h7-8H,5-6,9H2,1-4H3 |
| InChIKey | SXEMUCPOTHFDGS-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.38 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |