C14H20FNO3S — CID 107326673
[1-(4-fluoro-2,6-dimethylphenyl)sulfonylpiperidin-4-yl]methanol (PubChem CID 107326673) has the molecular formula C14H20FNO3S and a molecular weight of 301.38 g/mol. Its IUPAC name is [1-(4-fluoro-2,6-dimethylphenyl)sulfonylpiperidin-4-yl]methanol.
| Compound Name | [1-(4-fluoro-2,6-dimethylphenyl)sulfonylpiperidin-4-yl]methanol |
|---|---|
| PubChem CID | 107326673 |
| Molecular Formula | C14H20FNO3S |
| Molecular Weight | 301.38 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | [1-(4-fluoro-2,6-dimethylphenyl)sulfonylpiperidin-4-yl]methanol |
| SMILES | Cc1cc(F)cc(C)c1S(=O)(=O)N1CCC(CO)CC1 |
| InChI | InChI=1S/C14H20FNO3S/c1-10-7-13(15)8-11(2)14(10)20(18,19)16-5-3-12(9-17)4-6-16/h7-8,12,17H,3-6,9H2,1-2H3 |
| InChIKey | WXKXIMPXVLZRRM-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.38 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |