C15H22FNO3S — CID 107326940
4-ethoxy-1-(4-fluoro-2,6-dimethylphenyl)sulfonylpiperidine (PubChem CID 107326940) has the molecular formula C15H22FNO3S and a molecular weight of 315.41 g/mol. Its IUPAC name is 4-ethoxy-1-(4-fluoro-2,6-dimethylphenyl)sulfonylpiperidine.
| Compound Name | 4-ethoxy-1-(4-fluoro-2,6-dimethylphenyl)sulfonylpiperidine |
|---|---|
| PubChem CID | 107326940 |
| Molecular Formula | C15H22FNO3S |
| Molecular Weight | 315.41 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | 4-ethoxy-1-(4-fluoro-2,6-dimethylphenyl)sulfonylpiperidine |
| SMILES | CCOC1CCN(S(=O)(=O)c2c(C)cc(F)cc2C)CC1 |
| InChI | InChI=1S/C15H22FNO3S/c1-4-20-14-5-7-17(8-6-14)21(18,19)15-11(2)9-13(16)10-12(15)3/h9-10,14H,4-8H2,1-3H3 |
| InChIKey | RFUWBURFMLXUEA-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.41 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |