C13H15FN2O3S — CID 107327297
4-(4-fluoro-2,6-dimethylphenyl)sulfonylmorpholine-2-carbonitrile (PubChem CID 107327297) has the molecular formula C13H15FN2O3S and a molecular weight of 298.34 g/mol. Its IUPAC name is 4-(4-fluoro-2,6-dimethylphenyl)sulfonylmorpholine-2-carbonitrile.
| Compound Name | 4-(4-fluoro-2,6-dimethylphenyl)sulfonylmorpholine-2-carbonitrile |
|---|---|
| PubChem CID | 107327297 |
| Molecular Formula | C13H15FN2O3S |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | 4-(4-fluoro-2,6-dimethylphenyl)sulfonylmorpholine-2-carbonitrile |
| SMILES | Cc1cc(F)cc(C)c1S(=O)(=O)N1CCOC(C#N)C1 |
| InChI | InChI=1S/C13H15FN2O3S/c1-9-5-11(14)6-10(2)13(9)20(17,18)16-3-4-19-12(7-15)8-16/h5-6,12H,3-4,8H2,1-2H3 |
| InChIKey | AEEAUELGWSEUFX-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 70.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |