C11H11BrFN3O3S — CID 116530479
4-(5-amino-4-bromo-2-fluorophenyl)sulfonylmorpholine-2-carbonitrile (PubChem CID 116530479) has the molecular formula C11H11BrFN3O3S and a molecular weight of 364.20 g/mol. Its IUPAC name is 4-(5-amino-4-bromo-2-fluorophenyl)sulfonylmorpholine-2-carbonitrile.
| Compound Name | 4-(5-amino-4-bromo-2-fluorophenyl)sulfonylmorpholine-2-carbonitrile |
|---|---|
| PubChem CID | 116530479 |
| Molecular Formula | C11H11BrFN3O3S |
| Molecular Weight | 364.20 g/mol |
| Exact Mass | 362.97 |
| IUPAC Name | 4-(5-amino-4-bromo-2-fluorophenyl)sulfonylmorpholine-2-carbonitrile |
| SMILES | N#CC1CN(S(=O)(=O)c2cc(N)c(Br)cc2F)CCO1 |
| InChI | InChI=1S/C11H11BrFN3O3S/c12-8-3-9(13)11(4-10(8)15)20(17,18)16-1-2-19-7(5-14)6-16/h3-4,7H,1-2,6,15H2 |
| InChIKey | GIDDLMIAAXREBQ-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 96.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.20 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|