C10H11N3O4S — CID 79676932
4-[(4-oxo-1H-pyridin-3-yl)sulfonyl]morpholine-2-carbonitrile (PubChem CID 79676932) has the molecular formula C10H11N3O4S and a molecular weight of 269.28 g/mol. Its IUPAC name is 4-[(4-oxo-1H-pyridin-3-yl)sulfonyl]morpholine-2-carbonitrile.
| Compound Name | 4-[(4-oxo-1H-pyridin-3-yl)sulfonyl]morpholine-2-carbonitrile |
|---|---|
| PubChem CID | 79676932 |
| Molecular Formula | C10H11N3O4S |
| Molecular Weight | 269.28 g/mol |
| Exact Mass | 269.05 |
| IUPAC Name | 4-[(4-oxo-1H-pyridin-3-yl)sulfonyl]morpholine-2-carbonitrile |
| SMILES | N#CC1CN(S(=O)(=O)c2c[nH]ccc2=O)CCO1 |
| InChI | InChI=1S/C10H11N3O4S/c11-5-8-7-13(3-4-17-8)18(15,16)10-6-12-2-1-9(10)14/h1-2,6,8H,3-4,7H2,(H,12,14) |
| InChIKey | GIMADXKTUBLVOX-UHFFFAOYSA-N |
| XLogP | -0.71 |
| TPSA | 103.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.28 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |