About 3-(3,4,5-trimethylpiperazin-1-yl)sulfonyl-1H-pyridin-4-one
3-(3,4,5-trimethylpiperazin-1-yl)sulfonyl-1H-pyridin-4-one (PubChem CID 114539246) has the molecular formula C12H19N3O3S
and a molecular weight of 285.37 g/mol. Its IUPAC name is 3-(3,4,5-trimethylpiperazin-1-yl)sulfonyl-1H-pyridin-4-one.
Molecular Properties
| Compound Name | 3-(3,4,5-trimethylpiperazin-1-yl)sulfonyl-1H-pyridin-4-one |
| PubChem CID | 114539246 |
| Molecular Formula | C12H19N3O3S |
| Molecular Weight | 285.37 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | 3-(3,4,5-trimethylpiperazin-1-yl)sulfonyl-1H-pyridin-4-one |
| SMILES | CC1CN(S(=O)(=O)c2c[nH]ccc2=O)CC(C)N1C |
| InChI | InChI=1S/C12H19N3O3S/c1-9-7-15(8-10(2)14(9)3)19(17,18)12-6-13-5-4-11(12)16/h4-6,9-10H,7-8H2,1-3H3,(H,13,16) |
| InChIKey | QQQVOIIRHUQSHB-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 73.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.37 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(3,4,5-trimethylpiperazin-1-yl)sulfonyl-1H-pyridin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,4,5-trimethylpiperazin-1-yl)sulfonyl-1H-pyridin-4-one?
The IUPAC name of 3-(3,4,5-trimethylpiperazin-1-yl)sulfonyl-1H-pyridin-4-one (CID 114539246) is 3-(3,4,5-trimethylpiperazin-1-yl)sulfonyl-1H-pyridin-4-one.
What is the SMILES notation for 3-(3,4,5-trimethylpiperazin-1-yl)sulfonyl-1H-pyridin-4-one?
The canonical SMILES for 3-(3,4,5-trimethylpiperazin-1-yl)sulfonyl-1H-pyridin-4-one is CC1CN(S(=O)(=O)c2c[nH]ccc2=O)CC(C)N1C.
What is the InChIKey of 3-(3,4,5-trimethylpiperazin-1-yl)sulfonyl-1H-pyridin-4-one?
The InChIKey is QQQVOIIRHUQSHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19N3O3S/c1-9-7-15(8-10(2)14(9)3)19(17,18)12-6-13-5-4-11(12)16/h4-6,9-10H,7-8H2,1-3H3,(H,13,16).
What are the key properties of 3-(3,4,5-trimethylpiperazin-1-yl)sulfonyl-1H-pyridin-4-one?
3-(3,4,5-trimethylpiperazin-1-yl)sulfonyl-1H-pyridin-4-one has a molecular weight of 285.37 g/mol, XLogP of 0.09, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,4,5-trimethylpiperazin-1-yl)sulfonyl-1H-pyridin-4-one is sourced from PubChem (CID 114539246), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).